| Cas No.: | 1423067-48-4 |
| Chemical Name: | (1R,5S,8s)-3-(4-(5-methyl-2-((2-methyl-4-(piperidine-1-carbonyl)benzyl)oxy)phenyl)thiazol-2-yl)-3-azabicyclo[3.2.1]octane-8-carboxylic acid |
| Synonyms: | BI-703704;BI703704 |
| SMILES: | [C@@]([H])12[C@H](C(O)=O)[C@@]([H])(CC1)CN(C1=NC(C3=CC(C)=CC=C3OCC3=CC=C(C(N4CCCCC4)=O)C=C3C)=CS1)C2 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent soluble guanylate cyclase (sGC) activator; reduces progression of renal damage in the ZSF1 rat, shows the potential as an effective therapy for diabetic nephropathy. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
