| Cas No.: | |
| Chemical Name: | N-(4-(oxazol-5-yl)phenyl)-4-(3-phenylisoxazol-5-yl)thiazol-2-amine |
| Synonyms: | IND-125;IND125 |
| SMILES: | S1C=C(C2ON=C(C3=CC=CC=C3)C=2)N=C1NC1=CC=C(C2OC=NC=2)C=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel brain penetrant antiprion compound with EC50 of 57 nM, prevents both PrP(Sc) accumulation and astrocytic gliosis in the cerebrum; prolongs the lives of mice expressing a chimeric human/mouse PrP transgene inoculated with Creutzfeldt-Jakob disease prions. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
