To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1426259-35-9 |
| Chemical Name: | N-(6-methylpyridin-2-yl)-4-(4-(pyridin-3-yl)phenyl)thiazol-2-amine |
| Synonyms: | IND 114338;IND114338 |
| SMILES: | S1C=C(C2=CC=C(C3=CC=CN=C3)C=C2)N=C1NC1=NC(C)=CC=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel antiprion compound with EC50 of 68 nM, significantly increases monoglycosylated/diglycosylated PrPSc. |
