| Cas No.: | 1950635-16-1 |
| Chemical Name: | E3 ligase Ligand-Linker Conjugates 17 |
| Synonyms: | Thalidomide-O-amido-C8-NH2 TFA;Thalidomide-O-amido-C8-NH2 (TFA);N-(8-aminooctyl)-2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamide 2,2,2-trifluoroacetate;BCP32541;AT18336;A936454;N-(8-aminooctyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoiso;E3 ligase Ligand-Linker Conjugates 17 |
| SMILES: | FC(C(=O)O[H])(F)F.O(C([H])([H])C(N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H])=O)C1=C([H])C([H])=C([H])C2=C1C(N(C2=O)C1([H])C(N([H])C(C([H])([H])C1([H])[H])=O)=O)=O |
| Formula: | C25H31F3N4O8 |
| M.Wt: | 572.5309 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | E3 ligase Ligand-Linker Conjugates 17 is a synthesized compound that incorporates an E3 ligase ligand and a linker used in PROTAC technology. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
