| Cas No.: | |
| Chemical Name: | ALC-0315 analgous-3 |
| Synonyms: | ALC0315 analgous3, ALC 0315 analgous 3 ,S19-1035 |
| SMILES: | CC1=NOC(C)=C1COC2=CC=CC=C2C(NC3=CC=CC=C3Cl)=O |
| Formula: | C19H17ClN2O3 |
| M.Wt: | 356.81 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
