| Cas No.: | |
| Chemical Name: | Sanofi Lipid VII |
| Synonyms: | Sanofi-Lipid-VII |
| SMILES: | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOCC(COCCOCCOCCOCCOC(=O)C1CCN(C)CC1)OCCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| Formula: | C68H131O12N |
| M.Wt: | 1154.79 |
| Purity: | >95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | US 2025/0114305 A1 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
