To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1229-29-4 |
| Chemical Name: | (3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride |
| Synonyms: | Doxepin Hydrochloride; Silenor; Adapin; Novoxapin; Aponal; Toruan; Quitaxon; Sinequan; Sinquan; Xepin; Zonalon; |
| SMILES: | Cl.CN(CC/C=C1\C2=CC=CC=C2COC2=CC=CC=C\12)C |
| Formula: | C19H22ClNO |
| M.Wt: | 315.84 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Doxepin HCl is a tricyclic antidepressant that is marketed worldwide.Doxepin inhibits the reuptake of serotonin and norepinephrine and acts as a antagonist at various serotonergic, adrenergic, musacrinic, dopaminergic and histaminergic receptors. In the doxepin-treated patients who completed the study (N = 20, 47.6+/-11.3), medication significantly increased sleep efficiency after acute (night 1, p < or = .001) and subchronic (night 28, p < or = .05) intake compared with the patients who received placebo (N = 20, 47.4+/-16.8 years of age). Doxepin to cause significantly (p < or = .05) better global improvement at the first day of treatment. |