| Cas No.: | 1083162-61-1 |
| Chemical Name: | FIN56,FIN-56 ,FIN 56 |
| Synonyms: | FIN56,FIN-56 ,FIN 56 |
| SMILES: | O=S(C1=CC(/C2=N\O)=C(C3=C2C=C(S(=O)(NC4CCCCC4)=O)C=C3)C=C1)(NC5CCCCC5)=O |
| Formula: | C25H31N3O6S2 |
| M.Wt: | 517.66 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | FIN56 is a specific inducer of ferroptosis. |
| In Vitro: | FIN56 causes the loss of GPX4 activity in cell lysates. FIN56-induced cell death is suppressed by GFP-GPX4 fusion protein overexpression. FIN56 triggers ferroptosis through a mechanism involving the regulation of GPX4 protein abundance[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
