| Cas No.: | 1219810-16-8 |
| Chemical Name: | 1H-Pyrido[3,4-b]indole-3-carboxylic acid, 2-(2-chloroacetyl)-2,3,4,9-tetrahydro-1-[4-(methoxycarbonyl)phenyl]-, methyl ester, (1S,3R)- |
| Synonyms: | RSL 3,RSL-3 |
| SMILES: | O=C([C@H]1CC2=C([C@H](C3=CC=C(C(OC)=O)C=C3)N1C(CCl)=O)NC4=C2C=CC=C4)OC |
| Formula: | C23H21ClN2O5 |
| M.Wt: | 440.88 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | RSL3 (1S,3R-) is a glutathione peroxidase 4 (GPX4) inhibitor with an EC50 of 10 μM in cellular assay. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
