| Cas No.: | 202592-23-2 |
| Chemical Name: | JQ1-Carboxylic acid |
| Synonyms: | 6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetic acid, 4-(4-chlorophenyl)-2,3,9-trimethyl-, (6s)-;(+)-JQ-1 carboxylic acid;JQ-1 carboxylic acid;2-((6R)-4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)acetic acid;LJOSBOOJFIRCSO-UHFFFAOYSA-N;(+/-)-4-(4-Chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetic acid;[(6S)-4-(4-Chlorophenyl)-2,3,9-trimethyl-6Hthieno[3,2-f;JQ-1 (carboxylic acid) |
| SMILES: | ClC1C([H])=C([H])C(=C([H])C=1[H])C1C2C(C([H])([H])[H])=C(C([H])([H])[H])SC=2N2C(C([H])([H])[H])=NN=C2C([H])(C([H])([H])C(=O)O[H])N=1 |
| Formula: | C19H17ClN4O2S |
| M.Wt: | 400.88 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | JQ-1 carboxylic acid is a highly potent, selective and cell-permeable BRD4 inhibitor with IC50s of 77 nM and 33 nM for BRD4(1) and BRD4(2), respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
