| Cas No.: | 1268524-71-5 |
| Chemical Name: | 4-(4-chlorophenyl)-2,3,9-trimethyl-1,1-dimethylethyl ester-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6R-acetic acid |
| Synonyms: | JQ-1,JQ1,-JQ1,JQ 1 |
| SMILES: | O=C(C[C@H]1N=C(C2=C(N3C1=NN=C3C)SC(C)=C2C)C4=CC=C(C=C4)Cl)OC(C)(C)C |
| Formula: | C23H25ClN4O2S |
| M.Wt: | 457 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | (-)-JQ-1 is the stereoisomer of (+)-JQ1. (+)-JQ1 potently decreases expression of both BRD4 target genes, whereas (−)-JQ1 has no effect. |
| In Vitro: | (−)-JQ1 shows no significant interaction with any bromodomain. Besides, (−)-JQ1 enantiomer is comparatively inactive in nuclear protein in testis (NUT) midline carcinoma (NMC)[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
