To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 23672-07-3 |
| SMILES: | CCN1CCC[C@H]1CNC(C1=CC(S(=O)(N)=O)=CC=C1OC)=O |
| Formula: | C15H23N3O4S |
| M.Wt: | 341.43 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Levosulpiride is the (S)-enantiomer of sulpiride, which is a D2 receptor a antagonist, an atypical antipsychotic drug of the benzamide class. |
