| Cas No.: | 1841444-11-8 |
| Chemical Name: | MK-6240 Precursor |
| SMILES: | N1C2N3C(C(OC(=O)N(C(OC(C)(C)C)=O)C4C(=CC=C(C=4C=2)C=1)[N+]([O-])=O)(C)C)=CC1C=CN=CC3=1 |
| Formula: | C25H23N5O6 |
| M.Wt: | 489.480025529861 |
| Purity: | >97% |
| Sotrage: | Powder-20°C3 years4°C2 yearsIn solvent-80°C6 months-20°C1 month |
| Description: | MK-6240 Precursor (6e) is the synthetic precursor of (18)F]-MK-6240. (18)F]-MK-6240 is a tau positron emission tomography (PET) tracer for neurofibrillary tangles (NFTs), exhibiting high specificity and selectivity for binding to NFTs. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
