| Cas No.: | 7413-34-5 |
| Chemical Name: | sodium (4-(((2,4-diaminopteridin-6-yl)methyl)(methyl)amino)benzoyl)-L-glutamate |
| Synonyms: | Methotrexate sodium; Amethopterin sodium; MTX sodium; Methotrexate disodium |
| SMILES: | NC1=NC(N)=C2C(N=CC(CN(C)C3=CC=C(C(N[C@@H](CCC(O[Na])=O)C(O[Na])=O)=O)C=C3)=N2)=N1 |
| Formula: | C20H20N8Na2O5 |
| M.Wt: | 498.40 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
