| Cas No.: | 18711-16-5 |
| Chemical Name: | NS 309; NS-309 |
| Synonyms: | NS 309; NS-309 |
| SMILES: | O=C(NC1=C/2C=CC(Cl)=C1Cl)C2=NO |
| Formula: | C8H4Cl2N2O2 |
| M.Wt: | 231.04 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | NS309 is a positive modulator of small- and intermediate- conductance Ca2+-activated K+ channels (KCa2 and KCa3.1 channels); increases Ca2+ sensitivity. Displays no activity at BK channels.IC50 value: Ca2+-activated K+ channelTarget: |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
