| Cas No.: | 956014-19-0 |
| Chemical Name: | NS 11021 |
| Synonyms: | NS 11021;N'-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]-N-[4-BROMO-2-(2H-TETRAZOL-5-YL-PHENYL]THIOUREA;N′-[3,5-Bis(trifluoromethyl)phenyl]-N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-thiourea;ns11021;1-(3,5-Bis(trifluoromethyl)phenyl)-3-(4-bromo-2-(2H-tetrazol-5-yl)phenyl)thiourea;Thiourea, N'-[3,5-bis(trifluoromethyl)phenyl]-N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-;1-(3,5-Bis-trifluoromethyl-phenyl)-3-[4-bromo-2-(1H-tetrazol-5-yl)-phenyl]-thiourea;1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]thiourea;C16H9BrF6N6S;SYN5051;AOB1480;BCP16316;N′-[3,5-Bis(trifluoromethyl)phenyl]-N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]thiourea (ACI);1-[3,5-Bis(trifluoromethyl)phenyl]-3-[4-bromo-2-(1H-tetrazol-5-yl)phenyl]thiourea |
| SMILES: | FC(C1C=C(C(F)(F)F)C=C(NC(NC2C(C3NN=NN=3)=CC(Br)=CC=2)=S)C=1)(F)F |
| Formula: | C16H9BrF6N6S |
| M.Wt: | 511.242280721664 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | NS 11021 is a potent and specific Ca2-activated big-conductance K+ Channels (KCa1.1 channels) activator. NS 11021 at concentrations above 0.3 μM activates KCa1.1 in a concentration-dependent manner by parallelshifting the channel activation curves to more negative potentials[1]. |
| Target: | Ca2+-activated big-conductance K+ Channels[1] |
| References: | [1]. Bentzen BH,et al. The small molecule NS11021 is a potent and specific activator of Ca2+-activated big-conductance K+ channels. Mol Pharmacol. 2007 Oct;72(4):1033-44. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
