| Cas No.: | 919973-83-4 |
| Chemical Name: | 4-Bromo-N-(2,3-dihydro-6-methoxy-1,3-dimethyl-2-oxo-1H-benzimidazol-5-yl)-2-methylbenzenesulfonamide |
| Synonyms: | OF-1|OF1 |
| SMILES: | CC1=C(C=CC(=C1)Br)S(=O)(=O)NC2=C(C=C3C(=C2)N(C(=O)N3C)C)OC |
| Formula: | C17H18BrN3O4S |
| M.Wt: | 440.31 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | OF-1 is a selective BRPF1B and BRPF2 bromodomain inhibitor with Kd values of 100 nM/500 nM for BRPF1B/BRPF2; 39-fold selectivity over BRD4. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
