To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1508-65-2 |
| SMILES: | Cl.CCN(CC#CCOC(C(C1C=CC=CC=1)(O)C1CCCCC1)=O)CC |
| Formula: | C22H32ClNO3 |
| M.Wt: | 393.95 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Oxybutynin is also a possible treatment of hyperhidrosis (hyper-active sweating) . |
