To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 136-40-3 |
| SMILES: | Cl.C1(/N=N/C2=CC=C(N)N=C2N)C=CC=CC=1 |
| Formula: | C11H12ClN5 |
| M.Wt: | 249.7 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Phenazopyridine Hcl is a chemical, which has a local analgesic effect, often used to alleviate the pain, irritation, discomfort, or urgency caused by urinary tract infections, surgery, or injury to the urinary tract. |
