| Cas No.: | 2245002-14-4 |
| Chemical Name: | A83B4C63 |
| Synonyms: | 4a,7a-Dihydro-2-[hydroxy(2-methoxyphenyl)methyl]-6-(1-naphthalenylmethyl)-1-[(4-nitrophenyl)amino]-1H-pyrrolo[3,4-b]pyridine-5,7(2H,6H)-dione |
| SMILES: | C1=CC(N(NC2C=CC([N+]([O-])=O)=CC=2)C2C(N(C(=O)C12)CC1=CC=CC2C1=CC=CC=2)=O)C(C1=C(OC)C=CC=C1)O |
| Formula: | C32H28N4O6 |
| M.Wt: | 564.587927818298 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
