| Cas No.: | 2869954-34-5 |
| Chemical Name: | Werner syndrome RecQ helicase-IN-1 |
| Synonyms: | [1,2,4]Triazolo[1,5-a]pyrimidine-4(7H)-acetamide, N-[2-chloro-4-(trifluoromethyl)phenyl]-2-(3,6-dihydro-2H-pyran-4-yl)-5-ethyl-6-[4-[(5-hydroxy-6-methyl-4-pyrimidinyl)carbonyl]-1-piperazinyl]-7-oxo-;Werner syndrome RecQ helicase-IN-1 |
| SMILES: | C12=NC(C3=CCOCC3)=NN1C(=O)C(N1CCN(C(C3C(O)=C(C)N=CN=3)=O)CC1)=C(CC)N2CC(NC1=CC=C(C(F)(F)F)C=C1Cl)=O |
| Formula: | C31H31ClF3N9O5 |
| M.Wt: | 702.08335518837 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
