| Cas No.: | 2095116-40-6 |
| Chemical Name: | Brigimadlin |
| Synonyms: | spiro[3H-indol-3,2'(1'H)-pyrrolo[2',3':4,5]pyrrolo[1,2-b]indazol]-7'-carbonsure, 6-chlor-3'-(3-chlor-2-fluorophenyl)-1'-(cyclopropylmethyl)-1,2,3',3'a,10',10'a-hexahydro-6'-methyl-2-oxo-, (3S,3'S,3a'S,10a'S)-;BI 907828;Brigimadlin |
| SMILES: | C(C1CC1)N1[C@@]2([H])CC3=C4C=CC(C(=O)O)=C(C)C4=NN3[C@@]2([H])[C@H](C2C=CC=C(Cl)C=2F)[C@@]21C(NC1=CC(Cl)=CC=C21)=O |
| Formula: | C31H25Cl2FN4O3 |
| M.Wt: | 591.459608793259 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
