| Cas No.: | 134271-74-2 |
| Chemical Name: | (E)-1-(2-aminophenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
| Synonyms: | TMBIM6 antagonist-1;(E)-1-(2-aminophenyl)-3-(3-nitrophenyl)prop-2-en-1-one;2'-Amino-3-nitro-trans-chalcone;1-(2-Aminophenyl)-3-(3-nitrophenyl)prop-2-en-1-one;TMBIM6 antagonist BIA;E75668;CDC25B-IN-2 |
| SMILES: | O=C(/C=C/C1C=CC=C(C=1)[N+](=O)[O-])C1C=CC=CC=1N |
| Formula: | C15H12N2O3 |
| M.Wt: | 268.267383575439 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CDC25B-IN-2 is a potent cdc25B inhibitor[1]. |
| In Vitro: | CDC25B-IN-2 (compound 27; 20 μg/mL) has cdc25B enzyme inhibitory activities 16.11% in vitro[1]. |
| References: | [1]. Zhao, F., et al. Synthesis and cdc25B inhibitory activity evaluation of chalcones. Chemistry of Natural Compounds, 2013,49(2), 206-214. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
