| Cas No.: | 2055496-11-0 |
| Chemical Name: | Cedirogant |
| Synonyms: | Cedirogant;X6466M4LVP;Cedirogant [INN];Cedirogant [USAN];BDBM292795;US10106501, Example EI-5;US10106501, Example EI-6;WHO 11460;(1-(2,4-Dichloro-3-((7-chloro-5-(trifluoromethyl)-1hindol-1-yl)methyl)benzoyl)piperidin-4-yl)acetic acid;4-Piperidineacetic acid, 1-(2,4-dichloro-3-((7-chloro-5-(trifluoromethyl)-1H-indol-1-yl)methyl)benzoyl)- |
| SMILES: | ClC1C(=C(C=CC=1C(N1CCC(CC(=O)O)CC1)=O)Cl)CN1C=CC2C=C(C(F)(F)F)C=C(C1=2)Cl |
| Formula: | C24H20Cl3F3N2O3 |
| M.Wt: | 547.781414031982 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
