| Cas No.: | 2170477-75-3 |
| Chemical Name: | RORgammat inverse agonist 13 |
| Synonyms: | 4-[[[[[2,6-Dichloro-2'-(trifluoromethoxy)[1,1'-biphenyl]-4-yl]amino]carbonyl]amino]methyl]benzeneacetic acid;RORγt inverse agonist 13;RORgammat inverse agonist 13;ROR;At inverse agonist 13;BDBM441828;AKOS040759911;2170477-75-3;2-[4-[[[3,5-dichloro-4-[2-(trifluoromethoxy)phenyl]phenyl]carbamoylamino]methyl]phenyl]acetic acid;CS-0133430;ROR??t inverse agonist 13;HY-131338;RORgamma t inverse agonist 13;CHEMBL4786768;EX-A5894;MS-29526;SCHEMBL20943259;US10647665, Example 1-15;G17729;ZBAVYJYWRYFFEJ-UHFFFAOYSA-N |
| SMILES: | ClC1C([H])=C(C([H])=C(C=1C1=C([H])C([H])=C([H])C([H])=C1OC(F)(F)F)Cl)N([H])C(N([H])C([H])([H])C1C([H])=C([H])C(C([H])([H])C(=O)O[H])=C([H])C=1[H])=O |
| Formula: | C23H17Cl2F3N2O4 |
| M.Wt: | 513.2933 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
