| Cas No.: | 260979-95-1 |
| Synonyms: | Enfumafungin |
| SMILES: | OC(OC1)[C@@]([C@](CC2)([H])[C@@]1([C@H]3O[C@]([C@@H]([C@H]4O)O)([H])O[C@@H]([C@H]4O)CO)C)(C[C@H]3OC(C)=O)C([C@@]2([H])[C@]5(CC[C@]6(C)[C@H](C)C(C)C)C)=CC[C@]5([C@@H]6C(O)=O)C |
| Formula: | C38H60O12 |
| M.Wt: | 708.88 |
| Purity: | >95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Peláez F, et, al. The discovery of enfumafungin, a novel antifungal compound produced by an endophytic Hormonema species biological activity and taxonomy of the producing organisms. Syst Appl Microbiol. 2000 Oct;23(3):333-43. [2]. Onishi J, et, al. Discovery of novel antifungal (1,3)-beta-D-glucan synthase inhibitors. Antimicrob Agents Chemother. 2000 Feb;44(2):368-77. |
| References: | [1]. Peláez F, et, al. The discovery of enfumafungin, a novel antifungal compound produced by an endophytic Hormonema species biological activity and taxonomy of the producing organisms. Syst Appl Microbiol. 2000 Oct;23(3):333-43. [2]. Onishi J, et, al. Discovery of novel antifungal (1,3)-beta-D-glucan synthase inhibitors. Antimicrob Agents Chemother. 2000 Feb;44(2):368-77. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
