| Cas No.: | 799247-52-2 |
| Chemical Name: | Pyribencarb |
| Synonyms: | methyl N-[[2-chloro-5-[(Z)-C-methyl-N-[(6-methylpyridin-2-yl)methoxy]carbonimidoyl]phenyl]methyl]carbamate;carbamic |
| SMILES: | ClC1=CC=C(/C(/C)=N/OCC2C=CC=C(C)N=2)C=C1CNC(=O)OC |
| Formula: | C18H20ClN3O3 |
| M.Wt: | 361.822703361511 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
