| Cas No.: | 2438637-64-8 |
| Chemical Name: | GNE684 |
| Synonyms: | 5H-Pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide, 6,7-dihydro-5-phenyl-N-[(3R)-2,3,4,5-tetrahydro-7-methoxy-1-methyl-2-oxo-1H-pyrido[3,4-b]azepin-3-yl]-, (5R)-rel-;GNE684 |
| SMILES: | N1=C(C(N[C@H]2C(=O)N(C)C3C=NC(OC)=CC=3CC2)=O)N=C2CC[C@H](C3=CC=CC=C3)N12 |
| Formula: | C23H24N6O3 |
| M.Wt: | 432.475064277649 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
