| Cas No.: | 2258671-03-1 |
| Chemical Name: | AC-003 |
| Synonyms: | AC003, AC 003 |
| SMILES: | O=C(NC1=CN2C=C(C3=CN=C4OCCN(C(=O)OC5CCOCC5)C4=C3)C=CC2=N1)C1CC1 |
| Formula: | C24H25N5O5 |
| M.Wt: | 463.49 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AC-003 is a novel, orally administered small-molecule inhibitor targeting receptor-interacting protein kinase 1 (RIPK1), demonstrating therapeutic potential for the treatment of idiopathic pulmonary fibrosis (IPF). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
