| Cas No.: | 1638611-48-9 |
| Chemical Name: | JC124 |
| Synonyms: | JC124;5-Chloro-2-methoxy-N-(4-(N-methylsulfamoyl)phenethyl)benzamide;BDBM50465503;ClC=1C=CC(=C(C(=O)NCCC2=CC=C(C=C2)S(NC)(=O)=O)C=1)OC;HY-120007;GLXC-21011;CS-0068845;5-chloro-2-methoxy-N-{2-[4-(methylsulfamoyl)phenyl]ethyl}benzamide;CHEMBL4277456;SCHEMBL16261128;5-chloro-2-methoxy-N-[2-[4-(methylsulfamoyl)phenyl]ethyl]benzamide;AKOS036901683;G17900;DA-64625;MS-26278;1638611-48-9 |
| SMILES: | ClC1C=CC(=C(C=1)C(NCCC1C=CC(=CC=1)S(NC)(=O)=O)=O)OC |
| Formula: | C17H19ClN2O4S |
| M.Wt: | 382.861762285233 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
