| Cas No.: | 2953044-98-7 |
| Chemical Name: | Lipid 119-23 |
| Synonyms: | Lipid 119 23 |
| SMILES: | CCCCCCCC/C=C\CCCCCCCC(N(C(CCCCCOC(CCCCCCC/C=C\CCCCCCCC)=O)C(NC1(C[C@@H](C2)C3)CC3CC2C1)=O)CCCN(C)C)=O |
| Formula: | C58H105N3O4 |
| M.Wt: | 908.47 |
| Purity: | >95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Accelerating ionizable lipid discovery for mRNA delivery using machine learning and combinatorial chemistry-Nature Materials volume 23, pages1002–1008 (2024)-Bowen Li,Robert S. Langer & Daniel G. Anderson |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
