| Cas No.: | |
| Chemical Name: | LIPID 331 |
| Synonyms: | LIPID-331,LIPID331 |
| SMILES: | O=C(OCCCCCCCC/C=C\C/C=C\CCCCC)CCCC1(CCCC(OCCCCCCCC/C=C\C/C=C\CCCCC)=O)C=NC(C(OC(C)(C)C)=O)N1CCN2CCCCC2CC |
| Formula: | C61H107N3O6 |
| M.Wt: | 978.52 |
| Purity: | >95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Enhancing the immunogenicity of lipid-nanoparticle mRNA vaccines by adjuvanting the ionizable lipid and the mRNA--Nature Biomedical Engineering (2023) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
