| Cas No.: | 1236109-67-3 |
| Chemical Name: | TUG-469 |
| Synonyms: | 3-(4-(((2'-methyl-[1,1'-biphenyl]-3-yl)methyl)amino)phenyl)propanoic acid;3-[4-[[3-(2-methylphenyl)phenyl]methylamino]phenyl]propanoic acid;3-(4-((3-(2-Methylphenyl)phenyl)methylamino)phenyl)propanoic acid;BDBM50343141;3-(4(2''-Methylbiphenyl-3-ylmethylamino)phenyl)propanoic acid |
| SMILES: | OC(CCC1C=CC(=CC=1)NCC1C=CC=C(C=1)C1C=CC=CC=1C)=O |
| Formula: | C23H23NO2 |
| M.Wt: | 345.43422627449 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
