| Cas No.: | 838818-26-1 |
| Chemical Name: | 2-[3-[[4-(4-Methoxyphenyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]propyl]-1H-benz[de]isoquinoline-1,3(2H)-dione |
| Synonyms: | wiki 4 |
| SMILES: | C(=O)1C2=C3C(C=CC=C3C(=O)N1CCCSC1N(C3=CC=C(OC)C=C3)C(C3C=CN=CC=3)=NN=1)=CC=C2 |
| Formula: | C29H23N5O3S |
| M.Wt: | 521.59 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | WIKI4 is a potent inhibitor of Wnt/β-catenin signaling (EC50 ~ 75 nM); inhibits auto-ADP-ribosylation of tankyrase 2 (TNKS2) (IC50 ~15 nM). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
