| Cas No.: | 2244520-98-5 |
| Chemical Name: | Homo-PROTAC cereblon degrader 1 |
| Synonyms: | Homo-PROTAC cereblon degrader 1 |
| SMILES: | O=C1C([H])(C([H])([H])C([H])([H])C(N1[H])=O)N1C(C2C([H])=C([H])C([H])=C(C=2C1=O)N([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])OC([H])([H])C([H])([H])N([H])C1=C([H])C([H])=C([H])C2C(N(C(C=21)=O)C1([H])C(N([H])C(C([H])([H])C1([H])[H])=O)=O)=O)=O |
| Formula: | C32H32N6O10 |
| M.Wt: | 660.630687713623 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Homo-PROTAC cereblon degrader 1 (compound 15a) is a highly potent and efficient cereblon (CRBN) degrader with only minimal effects on IKZF1 and IKZF3[1]. |
| Target: | Celeblon[1]. |
| References: | [1]. Steinebach C, et al. Homo-PROTACs for the Chemical Knockdown of Cereblon. ACS Chem Biol. 2018 Sep 21;13(9):2771-2782. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
