| Cas No.: | 2982842-90-8 |
| Chemical Name: | 306-O12B-3 |
| Synonyms: | bis(2-(octyldisulfaneyl)ethyl) 3,3'-((4-methyl-11-oxo-12-oxa-15,16-dithia-4,8-diazatetracosyl)azanediyl)dipropionate;306O12B3,306 O12B 3 |
| SMILES: | O=C(OCCSSCCCCCCCC)CCN(CCCN(C)CCCNCCC(OCCSSCCCCCCCC)=O)CCC(OCCSSCCCCCCCC)=O |
| Formula: | C46H91N3O6S6 |
| M.Wt: | 974.6 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | 1. Yang, L., Ma, F., Liu, F., et al. Efficient delivery of antisense oligonucleotides using bioreducible lipid nanoparticles in vitro and in vivo. Mol. Ther. Nucleic Acids 19, 1357-1367 (2020). 2. Ma, F., Yang, L., Sun, Z., et al. Neurotransmitter-derived lipidoids (NT-lipidoids) for enhanced brain delivery through intravenous injection. Sci. Adv. 6(30), eabb4429 (2020). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
