| Cas No.: | 2739805-63-9 |
| Chemical Name: | NT1-O12B |
| Synonyms: | NT1O12B,, NT1 O12B |
| SMILES: | CCCCCCCCSSCCOC(CCN(CCC(OCCSSCCCCCCCC)=O)CCC1=CNC2=C1C=CC=C2)=O |
| Formula: | C36H60N2O4S4 |
| M.Wt: | 713.13 |
| Purity: | >95% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
