| Cas No.: | 1998705-64-8 |
| Chemical Name: | Bemnifosbuvir |
| Synonyms: | Propan-2-yl (2S)-2-[[[(2R,3R,4R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methylox;AT-511;Bemnifosbuvir |
| SMILES: | P(N[C@H](C(=O)OC(C)C)C)(=O)(OC1C=CC=CC=1)OC[C@@H]1[C@H]([C@](C)(C(N2C=NC3C(NC)=NC(N)=NC2=3)O1)F)O |
| Formula: | C24H33FN7O7P |
| M.Wt: | 581.533689260483 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AT-511 is a novel phosphoramidate prodrug of 2'-fluoro-2'-C-methylguanosine-5'-monophosphate that has potent in vitro activity against HCV. The EC50 of AT-511, determined using HCV laboratory strains and clinical isolates with genotypes 1-5, ranged from 5 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
