| Cas No.: | 1204310-73-5 |
| Chemical Name: | 2-deoxy-D-araHex3Ac6Ac |
| Synonyms: | WP1122;2-deoxy-D-araHex3Ac6Ac |
| SMILES: | O1C(C[C@H]([C@@H]([C@H]1COC(C)=O)O)OC(C)=O)O |
| Formula: | C10H16O7 |
| M.Wt: | 248.229844093323 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | WP-1122(WP 1122) is a candidate drug to treat SARS-COV-2(COVID-19) .2-DG completely prevented SARS-CoV–2 replication in Caco–2 cells. Glycolysis is a process by which cells convert glucose into energy and infected (host) cells are induced by viruses to dramatically increase their dependence on glycolysis. WP1122 is a prodrug of 2-DG whereby chemical elements are added to 2-DG to improve its delivery in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
