| Cas No.: | 160800-65-7 |
| Chemical Name: | Boc-Dap-NE |
| Synonyms: | 1-Pyrrolidinecarboxylic acid,2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-, 1,1-dimethylethyl ester, (2S)-;Boc-Dap-NE;(S)-tert-butyl 2-((1R,2R)-3-(((1S,2R)-1-hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate;tert-butyl (2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate;TERT-BUTYL 2-((1R,2R)-3-(((1S,2R)-1-HYDROXY-1-PHENYLPROPAN-2-YL)AMINO)-1-METHOXY-2-METHYL-3-OXOPROPYL)PYRROLIDINE-1-CARBOXYLATE;1-Pyrrolidinecarboxylic acid, 2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-, 1,1-dimethylethyl ester, (2S)- |
| SMILES: | O(C)C(C(C(NC(C)C(C1C=CC=CC=1)O)=O)C)C1CCCN1C(=O)OC(C)(C)C |
| Formula: | C23H36N2O5 |
| M.Wt: | 420.542346954346 |
| Purity: | >98% |
| Sotrage: | 4°C, stored under nitrogen*In solvent : -80°C, 6 months; -20°C, 1 month (stored under nitrogen) |
| Description: | Boc-Dap-NE, a dipeptide, is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Target: | Cleavable |
| In Vitro: | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
