| Cas No.: | 160036-44-2 |
| Chemical Name: | Fmoc-Gly-Gly-Phe-OH |
| Synonyms: | L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycylglycyl-;Fmoc-Gly-Gly-Phe-OH;(2S)-2-{2-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetamido]acetamido}-3-phenylpropanoic acid;N-Fmoc-glycyl-glycyl-L-phenylalanine;Fmoc-GGF |
| SMILES: | C1C2=C(C3=C(C2COC(NCC(NCC(N[C@H](C(O)=O)CC2=CC=CC=C2)=O)=O)=O)C=CC=C3)C=CC=1 |
| Formula: | C28H27N3O6 |
| M.Wt: | 501.53 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
