| Cas No.: | 2118356-96-8 |
| Chemical Name: | N-(5-cyclobutyl-1H-pyrazol-3-yl)-2-(4-((5-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)pentyl)oxy)phenyl)acetamide |
| SMILES: | C(NC1C=C(C2CCC2)NN=1)(=O)CC1=CC=C(OCCCCCOC2=CC=CC3=C2C(=O)N(C2CCC(=O)NC2=O)C3=O)C=C1 |
| Formula: | C33H35N5O7 |
| M.Wt: | 613.671 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A heterobifunctional small molecule PROTAC capable of cereblon mediated proteasomal degradation of CDK9; selectively degrades CDK9 while sparing other CDK family members in HCT116 cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
