| Cas No.: | 25279-15-6 |
| Chemical Name: | (8R,10R,12R,14R,17S)-12-hydroxy-17-((2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyltetrahydrofuran-2-yl)-4,4,8,10,14-pentamethylhexadecahydro-3H-cyclopenta[a]phenanthren-3-one |
| Synonyms: | EDD 3 |
| SMILES: | C1[C@@](C)2C(CC[C@](C)3C2C[C@H](O)C2[C@]3(C)CC[C@H]2[C@](C)2CC[C@@H](C(O)(C)C)O2)C(C)(C)C(=O)C1 |
| Formula: | C30H50O4 |
| M.Wt: | 474.715610027313 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel Notch inhibitor that reduces protein expression of NOTCH1, NICD and HES1 in HEK293 cells and downregulates Notch target genes; inhibits proliferation and induces G0/G1 cell cycle arrest of ORL-150 cells through inducing p27KIP1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
