| Cas No.: | 2301866-59-9 |
| Chemical Name: | CID 134813646 |
| Synonyms: | CID 134813646;1-(1-(3-Chloro-4-(2-chloro-4-(trifluoromethoxy)phenoxy)pyridin-2-yl)piperidin-4-yl)-3-(pyridin-3-yl)thiourea;1-[1-[3-chloro-4-[2-chloro-4-(trifluoromethoxy)phenoxy]pyridin-2-yl]piperidin-4-yl]-3-pyridin-3-ylthiourea;DO 264;GTPL10250;compound 46;DO264;DO-264;DO 264 |
| SMILES: | ClC1=C(C([H])=C([H])N=C1N1C([H])([H])C([H])([H])C([H])(C([H])([H])C1([H])[H])N([H])C(N([H])C1=C([H])N=C([H])C([H])=C1[H])=S)OC1C([H])=C([H])C(=C([H])C=1Cl)OC(F)(F)F |
| Formula: | C23H20Cl2F3N5O2S |
| M.Wt: | 558.403411865234 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DO264 is an inhibitor of α/β-hydrolase domain-containing protein 12 (ABHD12; IC50 = 11 nM).It inhibits ABHD12-dependent hydrolysis of lysophosphatidylserine (lyso-PS) in mouse brain membrane lysates (IC50 = 2.8 nM) and human THP-1 cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
