| Cas No.: | |
| Chemical Name: | Lipid MK16 |
| Synonyms: | Lipid-MK16,MK 16, MK-16 |
| SMILES: | CC(OCCCCCC)OCCCCCCN(CCCCCCOC(C)OCCCCCC)CCCCCCNC(CC[C@H]1CC[C@@](C2=CC(F)=CC=C2F)(S(C3=CC=C(Cl)C=C3)(=O)=O)CC1)=O |
| Formula: | C55H91ClF2N2O7S |
| M.Wt: | 997.84 |
| Purity: | >98% |
| Sotrage: | -20 |
| Publication: | [1]. Wang C, et al., Blood-brain-barrier-crossing lipid nanoparticles for mRNA delivery to the central nervous system. Nat Mater. 2025 Feb 17. |
| Description: | MK-16 is a specialized lipid designed to traverse the blood-brain barrier (BBB) for effective mRNA delivery. Its formulation, MK 16 BLNP, leverages dual mechanisms involving caveolae and γ-secretase to facilitate BBB penetration, ensuring the targeted and efficient transport of functional mRNA to diverse brain cell types. Demonstrating excellent tolerability across a range of dosing regimens, MK16 BLNP represents a promising platform for brain-targeted therapeutic applications. |
| References: | [1]. Wang C, et al., Blood-brain-barrier-crossing lipid nanoparticles for mRNA delivery to the central nervous system. Nat Mater. 2025 Feb 17. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
