| Cas No.: | 2924858-25-1 |
| Chemical Name: | PT-179 |
| Synonyms: | 2-(2,6-dioxopiperidin-3-yl)-5-morpholinoisoindoline-1,3-dione;1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-(4-morpholinyl)- |
| SMILES: | O=C1C2=CC(N3CCOCC3)=CC=C2C(N1C1CCC(NC1=O)=O)=O |
| Formula: | C17H17N3O5 |
| M.Wt: | 343.333984136581 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Continuous evolution of compact protein degradation tags regulated by selective molecular glues-Science . 2024 Mar 15;383(6688):eadk4422. doi: 10.1126/science.adk4422. Epub 2024 Mar 15. |
| Description: | PT-179 is a new orthogonal immunomodulatory drug (IMiD) derivative that binds CRBN but does not induce degradation of off-target proteins. PT-179 potently degrades proteins fused to SD40 at either the N or C terminus. |
| References: | Continuous evolution of compact protein degradation tags regulated by selective molecular glues-Science . 2024 Mar 15;383(6688):eadk4422. doi: 10.1126/science.adk4422. Epub 2024 Mar 15. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
