| Cas No.: | 10095-06-4 |
| Chemical Name: | Temgicoluril |
| Synonyms: | Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione,tetrahydro-1,3,4,6-tetramethyl-;2,4,6,8-Tetraazabicyclo[3.3.0]octane-3,7-dione, 2,4,6,8-tetramethyl-;1,3,4,6-Tetramethyltetrahydroimidazo[4,5-d]-imidazole-2,5(1H,3H)-dione;Temgicoluril |
| SMILES: | CN1C2C(N(C)C1=O)N(C)C(=O)N2C |
| Formula: | C8H14N4O2 |
| M.Wt: | 198.22236 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Tetramethylglycerol (Tetramethylglycoluril) is a small molecule that acts on GABA Receptor, with anti-anxiety activity[1]. |
| References: | [1]. Val'dman AV, Zaikonnikova IV, Kozlovskaia MM, Zimakova IE. Izuchenie osobennosteĭ spektra psikhotropnogo deĭstviia mebikara [Characteristics of the psychotropic spectrum of action of mebicar]. Biull Eksp Biol Med. 1980 May;89(5):568-70. Russian. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
