| Cas No.: | 1477949-42-0 |
| Chemical Name: | Santacruzamate A |
| Synonyms: | Santacruzamate A;Carbamic acid, N-[4-oxo-4-[(2-phenylethyl)amino]butyl]-, ethyl ester;CAY10683;CAY-10683;CAY10683 (SantacruzaMate A);Santacruzamate A (CAY10683);ethyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate;CAY10683(Santacruzamate A);GTPL7916;HMS3653L15;HMS3743I13;BCP11377;N-[4-oxo-4-[(2-Phenylethyl)amino]butyl]-carbamic acid ethyl ester;CAY 10683;s7595;2307AH;BC600730;AK316553;SW219695-1;ethyl 4-oxo-4-(phenethylam |
| SMILES: | O=C(C([H])([H])C([H])([H])C([H])([H])N([H])C(=O)OC([H])([H])C([H])([H])[H])N([H])C([H])([H])C([H])([H])C1C([H])=C([H])C([H])=C([H])C=1[H] |
| Formula: | C15H22N2O3 |
| M.Wt: | 278.3468 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Santacruzamate A is a potent and selective histone deacetylase inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
