| Cas No.: | 76937-77-4 |
| Chemical Name: | Indoleacetic Acid-d4 |
| Synonyms: | Indoleacetic Acid-d4;CID 131698716;SEOVTRFCIGRIMH-RHQRLBAQSA-N;[2H4]-Indoleacetic Acid;HY-18569S1;4,5,6,7-tetradeutero-indole-3-acetic acid;1H-Indole-3-acetic acid D4 (indole-4,5,6,7-D4); 1H-Indole-4,5,6,7-d4-3-acetic acid; 2-(4,5,6,7-Tetradeuterio-1H-indol-3-yl)acetic acid; 2-(3-Indolyl-4,5,6,7-d4)acetic acid; 3-Indolylacetic acid-d4;76937-77-4;2-(4,5,6,7-Tetradeuterio-1H-indol-3-yl)acetic acid;CS-0129162;3-Indoleacetic acid-d4 |
| SMILES: | OC(CC1=C([2H])C2C([2H])=C([2H])C([2H])=CC=2N1)=O |
| Formula: | C10H9NO2 |
| M.Wt: | 179.21 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
