To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2154342-57-9 |
| Chemical Name: | 2-(2,6-Dioxopiperidin-3-yl)-4-piperazin-1-ylisoindole-1,3-dione;hydrochloride |
| Synonyms: | 2-(2,6-Dioxopiperidin-3-yl)-4-piperazin-1-ylisoindole-1,3-dione;hydrochloride |
| SMILES: | Cl[H].O=C1C2=C(C([H])=C([H])C([H])=C2N2C([H])([H])C([H])([H])N([H])C([H])([H])C2([H])[H])C(N1C1([H])C(N([H])C(C([H])([H])C1([H])[H])=O)=O)=O |
| Formula: | C17H19ClN4O4 |
| M.Wt: | 378.8102 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
